C28H40O2 — CID 145122150
[(2E,6Z)-2-but-1-en-2-yl-8-[(1R)-1,4-dimethylcyclopent-2-en-1-yl]-6-methyl-4,5-dimethylidenenona-2,6,8-trienyl] acetate;prop-1-ene (PubChem CID 145122150) has the molecular formula C28H40O2 and a molecular weight of 408.63 g/mol. Its IUPAC name is [(2E,6Z)-2-but-1-en-2-yl-8-[(1R)-1,4-dimethylcyclopent-2-en-1-yl]-6-methyl-4,5-dimethylidenenona-2,6,8-trienyl] acetate;prop-1-ene.
| Compound Name | [(2E,6Z)-2-but-1-en-2-yl-8-[(1R)-1,4-dimethylcyclopent-2-en-1-yl]-6-methyl-4,5-dimethylidenenona-2,6,8-trienyl] acetate;prop-1-ene |
|---|---|
| PubChem CID | 145122150 |
| Molecular Formula | C28H40O2 |
| Molecular Weight | 408.63 g/mol |
| Exact Mass | 408.30 |
| IUPAC Name | [(2E,6Z)-2-but-1-en-2-yl-8-[(1R)-1,4-dimethylcyclopent-2-en-1-yl]-6-methyl-4,5-dimethylidenenona-2,6,8-trienyl] acetate;prop-1-ene |
| SMILES | C=C(/C=C(/COC(C)=O)C(=C)CC)C(=C)/C(C)=C\C(=C)[C@@]1(C)C=CC(C)C1.C=CC |
| InChI | InChI=1S/C25H34O2.C3H6/c1-10-18(3)24(16-27-23(8)26)14-20(5)22(7)19(4)13-21(6)25(9)12-11-17(2)15-25;1-3-2/h11-14,17H,3,5-7,10,15-16H2,1-2,4,8-9H3;3H,1H2,2H3/b19-13-,24-14-;/t17?,25-;/m0./s1 |
| InChIKey | HWMOOOCEILMUFA-CKTJVWNVSA-N |
| XLogP | 7.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.63 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|