C30H44O3 — CID 145122188
[(4Z,8Z)-10-[(1R)-1,4-dimethylcyclopent-2-en-1-yl]-8-ethyl-4-(1-methoxyethenyl)-6,7-dimethylideneundeca-4,8,10-trienyl] acetate;prop-1-ene (PubChem CID 145122188) has the molecular formula C30H44O3 and a molecular weight of 452.68 g/mol. Its IUPAC name is [(4Z,8Z)-10-[(1R)-1,4-dimethylcyclopent-2-en-1-yl]-8-ethyl-4-(1-methoxyethenyl)-6,7-dimethylideneundeca-4,8,10-trienyl] acetate;prop-1-ene.
| Compound Name | [(4Z,8Z)-10-[(1R)-1,4-dimethylcyclopent-2-en-1-yl]-8-ethyl-4-(1-methoxyethenyl)-6,7-dimethylideneundeca-4,8,10-trienyl] acetate;prop-1-ene |
|---|---|
| PubChem CID | 145122188 |
| Molecular Formula | C30H44O3 |
| Molecular Weight | 452.68 g/mol |
| Exact Mass | 452.33 |
| IUPAC Name | [(4Z,8Z)-10-[(1R)-1,4-dimethylcyclopent-2-en-1-yl]-8-ethyl-4-(1-methoxyethenyl)-6,7-dimethylideneundeca-4,8,10-trienyl] acetate;prop-1-ene |
| SMILES | C=C(/C=C(/CCCOC(C)=O)C(=C)OC)C(=C)/C(=C\C(=C)[C@@]1(C)C=CC(C)C1)CC.C=CC |
| InChI | InChI=1S/C27H38O3.C3H6/c1-10-25(17-21(4)27(8)14-13-19(2)18-27)22(5)20(3)16-26(23(6)29-9)12-11-15-30-24(7)28;1-3-2/h13-14,16-17,19H,3-6,10-12,15,18H2,1-2,7-9H3;3H,1H2,2H3/b25-17-,26-16-;/t19?,27-;/m0./s1 |
| InChIKey | WPSNAEFKPOGKDR-AFDUGWGDSA-N |
| XLogP | 8.22 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.68 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|