C33H46O4 — CID 145122194
2-[(3E,7Z,11Z)-8-ethyl-2-methoxy-14,17-dimethyl-5,6,9,10,13-pentamethylideneoctadeca-1,3,7,11-tetraen-3-yl]oxyethyl prop-2-enoate (PubChem CID 145122194) has the molecular formula C33H46O4 and a molecular weight of 506.73 g/mol. Its IUPAC name is 2-[(3E,7Z,11Z)-8-ethyl-2-methoxy-14,17-dimethyl-5,6,9,10,13-pentamethylideneoctadeca-1,3,7,11-tetraen-3-yl]oxyethyl prop-2-enoate.
| Compound Name | 2-[(3E,7Z,11Z)-8-ethyl-2-methoxy-14,17-dimethyl-5,6,9,10,13-pentamethylideneoctadeca-1,3,7,11-tetraen-3-yl]oxyethyl prop-2-enoate |
|---|---|
| PubChem CID | 145122194 |
| Molecular Formula | C33H46O4 |
| Molecular Weight | 506.73 g/mol |
| Exact Mass | 506.34 |
| IUPAC Name | 2-[(3E,7Z,11Z)-8-ethyl-2-methoxy-14,17-dimethyl-5,6,9,10,13-pentamethylideneoctadeca-1,3,7,11-tetraen-3-yl]oxyethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCO/C(=C\C(=C)C(=C)/C=C(/CC)C(=C)C(=C)/C=C\C(=C)C(C)CCC(C)C)C(=C)OC |
| InChI | InChI=1S/C33H46O4/c1-13-31(29(10)26(7)18-17-25(6)24(5)16-15-23(3)4)21-27(8)28(9)22-32(30(11)35-12)36-19-20-37-33(34)14-2/h14,17-18,21-24H,2,6-11,13,15-16,19-20H2,1,3-5,12H3/b18-17-,31-21-,32-22+ |
| InChIKey | VVKASKIEFHKVLT-AXVCKSKKSA-N |
| XLogP | 8.52 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.73 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|