C29H46O3 — CID 145122197
(4E,8Z)-4-(2-methoxyethoxy)-11,14-dimethyl-3,6,7,10-tetramethylidenehexadeca-4,8-diene;2-methylprop-2-enal (PubChem CID 145122197) has the molecular formula C29H46O3 and a molecular weight of 442.68 g/mol. Its IUPAC name is (4E,8Z)-4-(2-methoxyethoxy)-11,14-dimethyl-3,6,7,10-tetramethylidenehexadeca-4,8-diene;2-methylprop-2-enal.
| Compound Name | (4E,8Z)-4-(2-methoxyethoxy)-11,14-dimethyl-3,6,7,10-tetramethylidenehexadeca-4,8-diene;2-methylprop-2-enal |
|---|---|
| PubChem CID | 145122197 |
| Molecular Formula | C29H46O3 |
| Molecular Weight | 442.68 g/mol |
| Exact Mass | 442.34 |
| IUPAC Name | (4E,8Z)-4-(2-methoxyethoxy)-11,14-dimethyl-3,6,7,10-tetramethylidenehexadeca-4,8-diene;2-methylprop-2-enal |
| SMILES | C=C(/C=C\C(=C)C(C)CCC(C)CC)C(=C)/C=C(/OCCOC)C(=C)CC.C=C(C)C=O |
| InChI | InChI=1S/C25H40O2.C4H6O/c1-10-19(3)12-13-21(5)22(6)14-15-23(7)24(8)18-25(20(4)11-2)27-17-16-26-9;1-4(2)3-5/h14-15,18-19,21H,4,6-8,10-13,16-17H2,1-3,5,9H3;3H,1H2,2H3/b15-14-,25-18+; |
| InChIKey | YMTYVXWFBBQARE-WJDHEGJQSA-N |
| XLogP | 7.95 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.68 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|