C22H40O4 — CID 145122199
acetaldehyde;(3E)-9-methoxy-4-(2-methoxyethoxy)-2,6-dimethyl-5-methylidenedeca-1,3-diene;prop-1-ene (PubChem CID 145122199) has the molecular formula C22H40O4 and a molecular weight of 368.56 g/mol. Its IUPAC name is acetaldehyde;(3E)-9-methoxy-4-(2-methoxyethoxy)-2,6-dimethyl-5-methylidenedeca-1,3-diene;prop-1-ene.
| Compound Name | acetaldehyde;(3E)-9-methoxy-4-(2-methoxyethoxy)-2,6-dimethyl-5-methylidenedeca-1,3-diene;prop-1-ene |
|---|---|
| PubChem CID | 145122199 |
| Molecular Formula | C22H40O4 |
| Molecular Weight | 368.56 g/mol |
| Exact Mass | 368.29 |
| IUPAC Name | acetaldehyde;(3E)-9-methoxy-4-(2-methoxyethoxy)-2,6-dimethyl-5-methylidenedeca-1,3-diene;prop-1-ene |
| SMILES | C=C(C)/C=C(/OCCOC)C(=C)C(C)CCC(C)OC.C=CC.CC=O |
| InChI | InChI=1S/C17H30O3.C3H6.C2H4O/c1-13(2)12-17(20-11-10-18-6)16(5)14(3)8-9-15(4)19-7;1-3-2;1-2-3/h12,14-15H,1,5,8-11H2,2-4,6-7H3;3H,1H2,2H3;2H,1H3/b17-12+;; |
| InChIKey | DZEKOMWRZOFULN-CWQUOYFRSA-N |
| XLogP | 5.51 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.56 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|