C27H40O3 — CID 145122207
ethane;(3R)-3-[(3E,7Z)-9-methoxy-3-(methoxymethyl)-5,6-dimethylidenedeca-1,3,7,9-tetraen-2-yl]-3,5-dimethylcyclopentene;prop-2-enal (PubChem CID 145122207) has the molecular formula C27H40O3 and a molecular weight of 412.61 g/mol. Its IUPAC name is ethane;(3R)-3-[(3E,7Z)-9-methoxy-3-(methoxymethyl)-5,6-dimethylidenedeca-1,3,7,9-tetraen-2-yl]-3,5-dimethylcyclopentene;prop-2-enal.
| Compound Name | ethane;(3R)-3-[(3E,7Z)-9-methoxy-3-(methoxymethyl)-5,6-dimethylidenedeca-1,3,7,9-tetraen-2-yl]-3,5-dimethylcyclopentene;prop-2-enal |
|---|---|
| PubChem CID | 145122207 |
| Molecular Formula | C27H40O3 |
| Molecular Weight | 412.61 g/mol |
| Exact Mass | 412.30 |
| IUPAC Name | ethane;(3R)-3-[(3E,7Z)-9-methoxy-3-(methoxymethyl)-5,6-dimethylidenedeca-1,3,7,9-tetraen-2-yl]-3,5-dimethylcyclopentene;prop-2-enal |
| SMILES | C=C(/C=C\C(=C)C(=C)/C=C(/COC)C(=C)[C@@]1(C)C=CC(C)C1)OC.C=CC=O.CC |
| InChI | InChI=1S/C22H30O2.C3H4O.C2H6/c1-16-11-12-22(6,14-16)20(5)21(15-23-7)13-18(3)17(2)9-10-19(4)24-8;1-2-3-4;1-2/h9-13,16H,2-5,14-15H2,1,6-8H3;2-3H,1H2;1-2H3/b10-9-,21-13-;;/t16?,22-;;/m0../s1 |
| InChIKey | CCWBQPAGISPNRF-FWFBXNFDSA-N |
| XLogP | 6.94 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.61 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|