C26H38O2 — CID 145122219
[(Z,2E)-8,11-dimethyl-3,4,7-trimethylidene-2-(2-methylidenebutylidene)dodec-5-enyl] 2-methylprop-2-enoate (PubChem CID 145122219) has the molecular formula C26H38O2 and a molecular weight of 382.59 g/mol. Its IUPAC name is [(Z,2E)-8,11-dimethyl-3,4,7-trimethylidene-2-(2-methylidenebutylidene)dodec-5-enyl] 2-methylprop-2-enoate.
| Compound Name | [(Z,2E)-8,11-dimethyl-3,4,7-trimethylidene-2-(2-methylidenebutylidene)dodec-5-enyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 145122219 |
| Molecular Formula | C26H38O2 |
| Molecular Weight | 382.59 g/mol |
| Exact Mass | 382.29 |
| IUPAC Name | [(Z,2E)-8,11-dimethyl-3,4,7-trimethylidene-2-(2-methylidenebutylidene)dodec-5-enyl] 2-methylprop-2-enoate |
| SMILES | C=C(/C=C(/COC(=O)C(=C)C)C(=C)C(=C)/C=C\C(=C)C(C)CCC(C)C)CC |
| InChI | InChI=1S/C26H38O2/c1-11-20(6)16-25(17-28-26(27)19(4)5)24(10)23(9)15-14-22(8)21(7)13-12-18(2)3/h14-16,18,21H,4,6,8-13,17H2,1-3,5,7H3/b15-14-,25-16- |
| InChIKey | LCAAPRKIYNBARH-APXHTMCCSA-N |
| XLogP | 7.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.59 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|