C28H41FO2 — CID 145122225
(5S)-1-fluoro-5-[(3E,7Z)-4-(methoxymethyl)-5,6,9-trimethylideneundeca-1,3,7-trien-2-yl]-3,5-dimethylcyclopentene;formaldehyde;2-methylprop-1-ene (PubChem CID 145122225) has the molecular formula C28H41FO2 and a molecular weight of 428.63 g/mol. Its IUPAC name is (5S)-1-fluoro-5-[(3E,7Z)-4-(methoxymethyl)-5,6,9-trimethylideneundeca-1,3,7-trien-2-yl]-3,5-dimethylcyclopentene;formaldehyde;2-methylprop-1-ene.
| Compound Name | (5S)-1-fluoro-5-[(3E,7Z)-4-(methoxymethyl)-5,6,9-trimethylideneundeca-1,3,7-trien-2-yl]-3,5-dimethylcyclopentene;formaldehyde;2-methylprop-1-ene |
|---|---|
| PubChem CID | 145122225 |
| Molecular Formula | C28H41FO2 |
| Molecular Weight | 428.63 g/mol |
| Exact Mass | 428.31 |
| IUPAC Name | (5S)-1-fluoro-5-[(3E,7Z)-4-(methoxymethyl)-5,6,9-trimethylideneundeca-1,3,7-trien-2-yl]-3,5-dimethylcyclopentene;formaldehyde;2-methylprop-1-ene |
| SMILES | C=C(/C=C\C(=C)C(=C)/C(=C\C(=C)[C@]1(C)CC(C)C=C1F)COC)CC.C=C(C)C.C=O |
| InChI | InChI=1S/C23H31FO.C4H8.CH2O/c1-9-16(2)10-11-18(4)20(6)21(15-25-8)13-19(5)23(7)14-17(3)12-22(23)24;1-4(2)3;1-2/h10-13,17H,2,4-6,9,14-15H2,1,3,7-8H3;1H2,2-3H3;1H2/b11-10-,21-13-;;/t17?,23-;;/m0../s1 |
| InChIKey | NYDAXCJASYVKNR-PQLYFOKMSA-N |
| XLogP | 8.05 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.63 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|