C28H40O3 — CID 145122252
2-[(4E,8Z,12Z)-11,14-dimethyl-3,6,7,10-tetramethylidenehexadeca-4,8,12-trien-4-yl]oxyethyl 2-methylprop-2-enoate (PubChem CID 145122252) has the molecular formula C28H40O3 and a molecular weight of 424.63 g/mol. Its IUPAC name is 2-[(4E,8Z,12Z)-11,14-dimethyl-3,6,7,10-tetramethylidenehexadeca-4,8,12-trien-4-yl]oxyethyl 2-methylprop-2-enoate.
| Compound Name | 2-[(4E,8Z,12Z)-11,14-dimethyl-3,6,7,10-tetramethylidenehexadeca-4,8,12-trien-4-yl]oxyethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 145122252 |
| Molecular Formula | C28H40O3 |
| Molecular Weight | 424.63 g/mol |
| Exact Mass | 424.30 |
| IUPAC Name | 2-[(4E,8Z,12Z)-11,14-dimethyl-3,6,7,10-tetramethylidenehexadeca-4,8,12-trien-4-yl]oxyethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCO/C(=C/C(=C)C(=C)/C=C\C(=C)C(C)/C=C\C(C)CC)C(=C)CC |
| InChI | InChI=1S/C28H40O3/c1-11-21(5)13-14-23(7)24(8)15-16-25(9)26(10)19-27(22(6)12-2)30-17-18-31-28(29)20(3)4/h13-16,19,21,23H,3,6,8-12,17-18H2,1-2,4-5,7H3/b14-13-,16-15-,27-19+ |
| InChIKey | VZUPSCSCASLPQU-AHVCRCOXSA-N |
| XLogP | 7.44 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.63 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|