C16H21FO2 — CID 145122261
(3E,7E)-7-fluoro-2-methoxy-4-(methoxymethyl)-9-methyl-5,6-dimethylidenedeca-1,3,7,9-tetraene (PubChem CID 145122261) has the molecular formula C16H21FO2 and a molecular weight of 264.34 g/mol. Its IUPAC name is (3E,7E)-7-fluoro-2-methoxy-4-(methoxymethyl)-9-methyl-5,6-dimethylidenedeca-1,3,7,9-tetraene.
| Compound Name | (3E,7E)-7-fluoro-2-methoxy-4-(methoxymethyl)-9-methyl-5,6-dimethylidenedeca-1,3,7,9-tetraene |
|---|---|
| PubChem CID | 145122261 |
| Molecular Formula | C16H21FO2 |
| Molecular Weight | 264.34 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | (3E,7E)-7-fluoro-2-methoxy-4-(methoxymethyl)-9-methyl-5,6-dimethylidenedeca-1,3,7,9-tetraene |
| SMILES | C=C(C)/C=C(/F)C(=C)C(=C)/C(=C\C(=C)OC)COC |
| InChI | InChI=1S/C16H21FO2/c1-11(2)8-16(17)14(5)13(4)15(10-18-6)9-12(3)19-7/h8-9H,1,3-5,10H2,2,6-7H3/b15-9-,16-8+ |
| InChIKey | WCQPAPPZTMLRRL-ANFWGNMCSA-N |
| XLogP | 4.26 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.34 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|