C29H38F2O2 — CID 145122282
(3Z,7E,11E,15Z)-7,11-difluoro-2-methoxy-3-(methoxymethyl)-14,17-dimethyl-5,6,9,10,13-pentamethylidenenonadeca-1,3,7,11,15-pentaene (PubChem CID 145122282) has the molecular formula C29H38F2O2 and a molecular weight of 456.62 g/mol. Its IUPAC name is (3Z,7E,11E,15Z)-7,11-difluoro-2-methoxy-3-(methoxymethyl)-14,17-dimethyl-5,6,9,10,13-pentamethylidenenonadeca-1,3,7,11,15-pentaene.
| Compound Name | (3Z,7E,11E,15Z)-7,11-difluoro-2-methoxy-3-(methoxymethyl)-14,17-dimethyl-5,6,9,10,13-pentamethylidenenonadeca-1,3,7,11,15-pentaene |
|---|---|
| PubChem CID | 145122282 |
| Molecular Formula | C29H38F2O2 |
| Molecular Weight | 456.62 g/mol |
| Exact Mass | 456.28 |
| IUPAC Name | (3Z,7E,11E,15Z)-7,11-difluoro-2-methoxy-3-(methoxymethyl)-14,17-dimethyl-5,6,9,10,13-pentamethylidenenonadeca-1,3,7,11,15-pentaene |
| SMILES | C=C(/C=C(/COC)C(=C)OC)C(=C)/C(F)=C/C(=C)C(=C)/C(F)=C\C(=C)C(C)/C=C\C(C)CC |
| InChI | InChI=1S/C29H38F2O2/c1-12-19(2)13-14-20(3)21(4)16-28(30)25(8)23(6)17-29(31)24(7)22(5)15-27(18-32-10)26(9)33-11/h13-17,19-20H,4-9,12,18H2,1-3,10-11H3/b14-13-,27-15-,28-16+,29-17+ |
| InChIKey | LBJDWZZVMOOPDJ-ZLZQCIMVSA-N |
| XLogP | 8.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.62 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|