C8H2F12O6 — CID 14512230
1,1,1,3,3,3-hexafluoropropan-2-yl 1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyloxy carbonate (PubChem CID 14512230) has the molecular formula C8H2F12O6 and a molecular weight of 422.07 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyloxy carbonate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyloxy carbonate |
|---|---|
| PubChem CID | 14512230 |
| Molecular Formula | C8H2F12O6 |
| Molecular Weight | 422.07 g/mol |
| Exact Mass | 421.97 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyloxy carbonate |
| SMILES | O=C(OOC(=O)OC(C(F)(F)F)C(F)(F)F)OC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H2F12O6/c9-5(10,11)1(6(12,13)14)23-3(21)25-26-4(22)24-2(7(15,16)17)8(18,19)20/h1-2H |
| InChIKey | ZRYOJMNEAOCXHW-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.07 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|