C29H52O3 — CID 145122330
[(Z)-4-(1-methoxyethenyl)-7,10,11,14-tetramethyl-6-methylidenehexadec-4-enyl] acetate;prop-1-ene (PubChem CID 145122330) has the molecular formula C29H52O3 and a molecular weight of 448.73 g/mol. Its IUPAC name is [(Z)-4-(1-methoxyethenyl)-7,10,11,14-tetramethyl-6-methylidenehexadec-4-enyl] acetate;prop-1-ene.
| Compound Name | [(Z)-4-(1-methoxyethenyl)-7,10,11,14-tetramethyl-6-methylidenehexadec-4-enyl] acetate;prop-1-ene |
|---|---|
| PubChem CID | 145122330 |
| Molecular Formula | C29H52O3 |
| Molecular Weight | 448.73 g/mol |
| Exact Mass | 448.39 |
| IUPAC Name | [(Z)-4-(1-methoxyethenyl)-7,10,11,14-tetramethyl-6-methylidenehexadec-4-enyl] acetate;prop-1-ene |
| SMILES | C=C(OC)/C(=C\C(=C)C(C)CCC(C)C(C)CCC(C)CC)CCCOC(C)=O.C=CC |
| InChI | InChI=1S/C26H46O3.C3H6/c1-10-19(2)13-14-20(3)21(4)15-16-22(5)23(6)18-26(24(7)28-9)12-11-17-29-25(8)27;1-3-2/h18-22H,6-7,10-17H2,1-5,8-9H3;3H,1H2,2H3/b26-18-; |
| InChIKey | AXDBVLWVIDZMAE-ZVOSEVRTSA-N |
| XLogP | 8.68 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.73 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|