C24H30O3 — CID 145122336
[(2E,5Z)-2-[2-[(1R)-1,4-dimethylcyclopent-2-en-1-yl]prop-2-enylidene]-7-methoxy-3,4-dimethylideneocta-5,7-dienyl] prop-2-enoate (PubChem CID 145122336) has the molecular formula C24H30O3 and a molecular weight of 366.50 g/mol. Its IUPAC name is [(2E,5Z)-2-[2-[(1R)-1,4-dimethylcyclopent-2-en-1-yl]prop-2-enylidene]-7-methoxy-3,4-dimethylideneocta-5,7-dienyl] prop-2-enoate.
| Compound Name | [(2E,5Z)-2-[2-[(1R)-1,4-dimethylcyclopent-2-en-1-yl]prop-2-enylidene]-7-methoxy-3,4-dimethylideneocta-5,7-dienyl] prop-2-enoate |
|---|---|
| PubChem CID | 145122336 |
| Molecular Formula | C24H30O3 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | [(2E,5Z)-2-[2-[(1R)-1,4-dimethylcyclopent-2-en-1-yl]prop-2-enylidene]-7-methoxy-3,4-dimethylideneocta-5,7-dienyl] prop-2-enoate |
| SMILES | C=CC(=O)OC/C(=C/C(=C)[C@@]1(C)C=CC(C)C1)C(=C)C(=C)/C=C\C(=C)OC |
| InChI | InChI=1S/C24H30O3/c1-9-23(25)27-16-22(21(6)18(3)10-11-20(5)26-8)14-19(4)24(7)13-12-17(2)15-24/h9-14,17H,1,3-6,15-16H2,2,7-8H3/b11-10-,22-14-/t17?,24-/m0/s1 |
| InChIKey | BRRQEDIHFKPCJW-KQPVFMBPSA-N |
| XLogP | 5.63 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|