C28H46O4 — CID 145122368
formaldehyde;(3E,7Z)-2-methoxy-3-(2-methoxyethoxy)-10,13-dimethyl-5,6,9-trimethylidenetetradeca-1,3,7-triene;2-methylprop-1-ene (PubChem CID 145122368) has the molecular formula C28H46O4 and a molecular weight of 446.67 g/mol. Its IUPAC name is formaldehyde;(3E,7Z)-2-methoxy-3-(2-methoxyethoxy)-10,13-dimethyl-5,6,9-trimethylidenetetradeca-1,3,7-triene;2-methylprop-1-ene.
| Compound Name | formaldehyde;(3E,7Z)-2-methoxy-3-(2-methoxyethoxy)-10,13-dimethyl-5,6,9-trimethylidenetetradeca-1,3,7-triene;2-methylprop-1-ene |
|---|---|
| PubChem CID | 145122368 |
| Molecular Formula | C28H46O4 |
| Molecular Weight | 446.67 g/mol |
| Exact Mass | 446.34 |
| IUPAC Name | formaldehyde;(3E,7Z)-2-methoxy-3-(2-methoxyethoxy)-10,13-dimethyl-5,6,9-trimethylidenetetradeca-1,3,7-triene;2-methylprop-1-ene |
| SMILES | C=C(/C=C\C(=C)C(C)CCC(C)C)C(=C)/C=C(\OCCOC)C(=C)OC.C=C(C)C.C=O |
| InChI | InChI=1S/C23H36O3.C4H8.CH2O/c1-17(2)10-11-18(3)19(4)12-13-20(5)21(6)16-23(22(7)25-9)26-15-14-24-8;1-4(2)3;1-2/h12-13,16-18H,4-7,10-11,14-15H2,1-3,8-9H3;1H2,2-3H3;1H2/b13-12-,23-16+;; |
| InChIKey | YVXVDYGFKNFMFZ-STMACIQMSA-N |
| XLogP | 7.39 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.67 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|