C35H53FO2 — CID 145122370
ethane;(4Z,8E,12Z)-8-fluoro-4-(2-methoxyethyl)-15,18-dimethyl-3,6,7,10,11,14-hexamethylidenenonadeca-4,8,12-triene;prop-2-enal (PubChem CID 145122370) has the molecular formula C35H53FO2 and a molecular weight of 524.81 g/mol. Its IUPAC name is ethane;(4Z,8E,12Z)-8-fluoro-4-(2-methoxyethyl)-15,18-dimethyl-3,6,7,10,11,14-hexamethylidenenonadeca-4,8,12-triene;prop-2-enal.
| Compound Name | ethane;(4Z,8E,12Z)-8-fluoro-4-(2-methoxyethyl)-15,18-dimethyl-3,6,7,10,11,14-hexamethylidenenonadeca-4,8,12-triene;prop-2-enal |
|---|---|
| PubChem CID | 145122370 |
| Molecular Formula | C35H53FO2 |
| Molecular Weight | 524.81 g/mol |
| Exact Mass | 524.40 |
| IUPAC Name | ethane;(4Z,8E,12Z)-8-fluoro-4-(2-methoxyethyl)-15,18-dimethyl-3,6,7,10,11,14-hexamethylidenenonadeca-4,8,12-triene;prop-2-enal |
| SMILES | C=C(/C=C\C(=C)C(C)CCC(C)C)C(=C)/C=C(/F)C(=C)C(=C)/C=C(/CCOC)C(=C)CC.C=CC=O.CC |
| InChI | InChI=1S/C30H43FO.C3H4O.C2H6/c1-12-22(4)29(17-18-32-11)19-27(9)28(10)30(31)20-26(8)25(7)16-15-24(6)23(5)14-13-21(2)3;1-2-3-4;1-2/h15-16,19-21,23H,4,6-10,12-14,17-18H2,1-3,5,11H3;2-3H,1H2;1-2H3/b16-15-,29-19-,30-20+;; |
| InChIKey | GVEQJENTQHVZPL-NQPXPTNPSA-N |
| XLogP | 10.58 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.81 |
| LogP ≤ 5 | 10.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|