C30H43FO — CID 145122371
(4Z,8E,12Z)-8-fluoro-4-(2-methoxyethyl)-15,18-dimethyl-3,6,7,10,11,14-hexamethylidenenonadeca-4,8,12-triene (PubChem CID 145122371) has the molecular formula C30H43FO and a molecular weight of 438.67 g/mol. Its IUPAC name is (4Z,8E,12Z)-8-fluoro-4-(2-methoxyethyl)-15,18-dimethyl-3,6,7,10,11,14-hexamethylidenenonadeca-4,8,12-triene.
| Compound Name | (4Z,8E,12Z)-8-fluoro-4-(2-methoxyethyl)-15,18-dimethyl-3,6,7,10,11,14-hexamethylidenenonadeca-4,8,12-triene |
|---|---|
| PubChem CID | 145122371 |
| Molecular Formula | C30H43FO |
| Molecular Weight | 438.67 g/mol |
| Exact Mass | 438.33 |
| IUPAC Name | (4Z,8E,12Z)-8-fluoro-4-(2-methoxyethyl)-15,18-dimethyl-3,6,7,10,11,14-hexamethylidenenonadeca-4,8,12-triene |
| SMILES | C=C(/C=C\C(=C)C(C)CCC(C)C)C(=C)/C=C(/F)C(=C)C(=C)/C=C(/CCOC)C(=C)CC |
| InChI | InChI=1S/C30H43FO/c1-12-22(4)29(17-18-32-11)19-27(9)28(10)30(31)20-26(8)25(7)16-15-24(6)23(5)14-13-21(2)3/h15-16,19-21,23H,4,6-10,12-14,17-18H2,1-3,5,11H3/b16-15-,29-19-,30-20+ |
| InChIKey | OFDMQCCBMYONSR-BLYCPEFLSA-N |
| XLogP | 9.18 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.67 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|