C34H50O3 — CID 145122415
(4Z,8E,12Z)-9-(2-methoxyethoxy)-15,18-dimethyl-3,6,7,10,11,14-hexamethylidenenonadeca-4,8,12-triene;2-methylprop-2-enal (PubChem CID 145122415) has the molecular formula C34H50O3 and a molecular weight of 506.77 g/mol. Its IUPAC name is (4Z,8E,12Z)-9-(2-methoxyethoxy)-15,18-dimethyl-3,6,7,10,11,14-hexamethylidenenonadeca-4,8,12-triene;2-methylprop-2-enal.
| Compound Name | (4Z,8E,12Z)-9-(2-methoxyethoxy)-15,18-dimethyl-3,6,7,10,11,14-hexamethylidenenonadeca-4,8,12-triene;2-methylprop-2-enal |
|---|---|
| PubChem CID | 145122415 |
| Molecular Formula | C34H50O3 |
| Molecular Weight | 506.77 g/mol |
| Exact Mass | 506.38 |
| IUPAC Name | (4Z,8E,12Z)-9-(2-methoxyethoxy)-15,18-dimethyl-3,6,7,10,11,14-hexamethylidenenonadeca-4,8,12-triene;2-methylprop-2-enal |
| SMILES | C=C(/C=C\C(=C)C(=C)/C=C(/OCCOC)C(=C)C(=C)/C=C\C(=C)C(C)CCC(C)C)CC.C=C(C)C=O |
| InChI | InChI=1S/C30H44O2.C4H6O/c1-12-23(4)14-16-26(7)28(9)21-30(32-20-19-31-11)29(10)27(8)18-17-25(6)24(5)15-13-22(2)3;1-4(2)3-5/h14,16-18,21-22,24H,4,6-10,12-13,15,19-20H2,1-3,5,11H3;3H,1H2,2H3/b16-14-,18-17-,30-21+; |
| InChIKey | FYBPCMKVDZBPPM-IEYHYGDBSA-N |
| XLogP | 9.23 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.77 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|