C23H35FO — CID 145122429
(4E,8E)-8-fluoro-4-(methoxymethyl)-11,14-dimethyl-3,6,7,10-tetramethylidenepentadeca-4,8-diene (PubChem CID 145122429) has the molecular formula C23H35FO and a molecular weight of 346.53 g/mol. Its IUPAC name is (4E,8E)-8-fluoro-4-(methoxymethyl)-11,14-dimethyl-3,6,7,10-tetramethylidenepentadeca-4,8-diene.
| Compound Name | (4E,8E)-8-fluoro-4-(methoxymethyl)-11,14-dimethyl-3,6,7,10-tetramethylidenepentadeca-4,8-diene |
|---|---|
| PubChem CID | 145122429 |
| Molecular Formula | C23H35FO |
| Molecular Weight | 346.53 g/mol |
| Exact Mass | 346.27 |
| IUPAC Name | (4E,8E)-8-fluoro-4-(methoxymethyl)-11,14-dimethyl-3,6,7,10-tetramethylidenepentadeca-4,8-diene |
| SMILES | C=C(/C=C(/COC)C(=C)CC)C(=C)/C(F)=C/C(=C)C(C)CCC(C)C |
| InChI | InChI=1S/C23H35FO/c1-10-17(4)22(15-25-9)13-20(7)21(8)23(24)14-19(6)18(5)12-11-16(2)3/h13-14,16,18H,4,6-8,10-12,15H2,1-3,5,9H3/b22-13-,23-14+ |
| InChIKey | MMBIWQRFKAXVAI-BQGZOASHSA-N |
| XLogP | 7.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.53 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|