C31H52O2 — CID 145122437
(4E,8Z)-5-ethyl-4-(methoxymethyl)-11,14-dimethyl-3,6,7,10-tetramethylidenehexadeca-4,8-diene;formaldehyde;2-methylprop-1-ene (PubChem CID 145122437) has the molecular formula C31H52O2 and a molecular weight of 456.76 g/mol. Its IUPAC name is (4E,8Z)-5-ethyl-4-(methoxymethyl)-11,14-dimethyl-3,6,7,10-tetramethylidenehexadeca-4,8-diene;formaldehyde;2-methylprop-1-ene.
| Compound Name | (4E,8Z)-5-ethyl-4-(methoxymethyl)-11,14-dimethyl-3,6,7,10-tetramethylidenehexadeca-4,8-diene;formaldehyde;2-methylprop-1-ene |
|---|---|
| PubChem CID | 145122437 |
| Molecular Formula | C31H52O2 |
| Molecular Weight | 456.76 g/mol |
| Exact Mass | 456.40 |
| IUPAC Name | (4E,8Z)-5-ethyl-4-(methoxymethyl)-11,14-dimethyl-3,6,7,10-tetramethylidenehexadeca-4,8-diene;formaldehyde;2-methylprop-1-ene |
| SMILES | C=C(/C=C\C(=C)C(C)CCC(C)CC)C(=C)/C(CC)=C(/COC)C(=C)CC.C=C(C)C.C=O |
| InChI | InChI=1S/C26H42O.C4H8.CH2O/c1-11-19(4)14-15-21(6)22(7)16-17-23(8)24(9)25(13-3)26(18-27-10)20(5)12-2;1-4(2)3;1-2/h16-17,19,21H,5,7-9,11-15,18H2,1-4,6,10H3;1H2,2-3H3;1H2/b17-16-,26-25-;; |
| InChIKey | RYMLACCVEJGHLK-YVJGOKMHSA-N |
| XLogP | 9.39 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.76 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|