C18H23FO3 — CID 145122447
2-[(4E,8E)-8-fluoro-10-methyl-3,6,7-trimethylideneundeca-4,8,10-trien-5-yl]oxyethyl formate (PubChem CID 145122447) has the molecular formula C18H23FO3 and a molecular weight of 306.38 g/mol. Its IUPAC name is 2-[(4E,8E)-8-fluoro-10-methyl-3,6,7-trimethylideneundeca-4,8,10-trien-5-yl]oxyethyl formate.
| Compound Name | 2-[(4E,8E)-8-fluoro-10-methyl-3,6,7-trimethylideneundeca-4,8,10-trien-5-yl]oxyethyl formate |
|---|---|
| PubChem CID | 145122447 |
| Molecular Formula | C18H23FO3 |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 2-[(4E,8E)-8-fluoro-10-methyl-3,6,7-trimethylideneundeca-4,8,10-trien-5-yl]oxyethyl formate |
| SMILES | C=C(C)/C=C(/F)C(=C)C(=C)/C(=C/C(=C)CC)OCCOC=O |
| InChI | InChI=1S/C18H23FO3/c1-7-14(4)11-18(22-9-8-21-12-20)16(6)15(5)17(19)10-13(2)3/h10-12H,2,4-9H2,1,3H3/b17-10+,18-11+ |
| InChIKey | JHYKUGAJBFHJQW-ODPUSEOTSA-N |
| XLogP | 4.57 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|