C26H31FO3 — CID 145122461
2-[(4E,8E,12Z)-8-fluoro-14-methyl-3,6,7,10,11-pentamethylidenepentadeca-4,8,12,14-tetraen-4-yl]oxyethyl prop-2-enoate (PubChem CID 145122461) has the molecular formula C26H31FO3 and a molecular weight of 410.53 g/mol. Its IUPAC name is 2-[(4E,8E,12Z)-8-fluoro-14-methyl-3,6,7,10,11-pentamethylidenepentadeca-4,8,12,14-tetraen-4-yl]oxyethyl prop-2-enoate.
| Compound Name | 2-[(4E,8E,12Z)-8-fluoro-14-methyl-3,6,7,10,11-pentamethylidenepentadeca-4,8,12,14-tetraen-4-yl]oxyethyl prop-2-enoate |
|---|---|
| PubChem CID | 145122461 |
| Molecular Formula | C26H31FO3 |
| Molecular Weight | 410.53 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | 2-[(4E,8E,12Z)-8-fluoro-14-methyl-3,6,7,10,11-pentamethylidenepentadeca-4,8,12,14-tetraen-4-yl]oxyethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCO/C(=C/C(=C)C(=C)/C(F)=C\C(=C)C(=C)/C=C\C(=C)C)C(=C)CC |
| InChI | InChI=1S/C26H31FO3/c1-10-19(5)25(29-14-15-30-26(28)11-2)17-22(8)23(9)24(27)16-21(7)20(6)13-12-18(3)4/h11-13,16-17H,2-3,5-10,14-15H2,1,4H3/b13-12-,24-16+,25-17+ |
| InChIKey | WLDWCSXKCSXBTE-BQIZTCNYSA-N |
| XLogP | 6.79 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.53 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|