About (3Z)-2-methoxy-3-(2-methoxyethyl)hexa-1,3,5-triene;2-methylprop-2-enal
(3Z)-2-methoxy-3-(2-methoxyethyl)hexa-1,3,5-triene;2-methylprop-2-enal (PubChem CID 145122476) has the molecular formula C14H22O3
and a molecular weight of 238.33 g/mol. Its IUPAC name is (3Z)-2-methoxy-3-(2-methoxyethyl)hexa-1,3,5-triene;2-methylprop-2-enal.
Molecular Properties
| Compound Name | (3Z)-2-methoxy-3-(2-methoxyethyl)hexa-1,3,5-triene;2-methylprop-2-enal |
| PubChem CID | 145122476 |
| Molecular Formula | C14H22O3 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.16 |
| IUPAC Name | (3Z)-2-methoxy-3-(2-methoxyethyl)hexa-1,3,5-triene;2-methylprop-2-enal |
| SMILES | C=C(C)C=O.C=C/C=C(/CCOC)C(=C)OC |
| InChI | InChI=1S/C10H16O2.C4H6O/c1-5-6-10(7-8-11-3)9(2)12-4;1-4(2)3-5/h5-6H,1-2,7-8H2,3-4H3;3H,1H2,2H3/b10-6-; |
| InChIKey | WIQXBYDYJKEMJS-OTUCAILMSA-N |
| XLogP | 3.06 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-2-methoxy-3-(2-methoxyethyl)hexa-1,3,5-triene;2-methylprop-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-2-methoxy-3-(2-methoxyethyl)hexa-1,3,5-triene;2-methylprop-2-enal?
The IUPAC name of (3Z)-2-methoxy-3-(2-methoxyethyl)hexa-1,3,5-triene;2-methylprop-2-enal (CID 145122476) is (3Z)-2-methoxy-3-(2-methoxyethyl)hexa-1,3,5-triene;2-methylprop-2-enal.
What is the SMILES notation for (3Z)-2-methoxy-3-(2-methoxyethyl)hexa-1,3,5-triene;2-methylprop-2-enal?
The canonical SMILES for (3Z)-2-methoxy-3-(2-methoxyethyl)hexa-1,3,5-triene;2-methylprop-2-enal is C=C(C)C=O.C=C/C=C(/CCOC)C(=C)OC.
What is the InChIKey of (3Z)-2-methoxy-3-(2-methoxyethyl)hexa-1,3,5-triene;2-methylprop-2-enal?
The InChIKey is WIQXBYDYJKEMJS-OTUCAILMSA-N. The full InChI is InChI=1S/C10H16O2.C4H6O/c1-5-6-10(7-8-11-3)9(2)12-4;1-4(2)3-5/h5-6H,1-2,7-8H2,3-4H3;3H,1H2,2H3/b10-6-;.
What are the key properties of (3Z)-2-methoxy-3-(2-methoxyethyl)hexa-1,3,5-triene;2-methylprop-2-enal?
(3Z)-2-methoxy-3-(2-methoxyethyl)hexa-1,3,5-triene;2-methylprop-2-enal has a molecular weight of 238.33 g/mol, XLogP of 3.06, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-2-methoxy-3-(2-methoxyethyl)hexa-1,3,5-triene;2-methylprop-2-enal is sourced from PubChem (CID 145122476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).