C32H52O4 — CID 145122485
(3Z,7Z)-2-methoxy-7-(2-methoxyethyl)-10,13-dimethyl-5,6,9-trimethylidene-14-(2-methylpropoxy)pentadeca-1,3,7-triene;2-methylprop-2-enal (PubChem CID 145122485) has the molecular formula C32H52O4 and a molecular weight of 500.76 g/mol. Its IUPAC name is (3Z,7Z)-2-methoxy-7-(2-methoxyethyl)-10,13-dimethyl-5,6,9-trimethylidene-14-(2-methylpropoxy)pentadeca-1,3,7-triene;2-methylprop-2-enal.
| Compound Name | (3Z,7Z)-2-methoxy-7-(2-methoxyethyl)-10,13-dimethyl-5,6,9-trimethylidene-14-(2-methylpropoxy)pentadeca-1,3,7-triene;2-methylprop-2-enal |
|---|---|
| PubChem CID | 145122485 |
| Molecular Formula | C32H52O4 |
| Molecular Weight | 500.76 g/mol |
| Exact Mass | 500.39 |
| IUPAC Name | (3Z,7Z)-2-methoxy-7-(2-methoxyethyl)-10,13-dimethyl-5,6,9-trimethylidene-14-(2-methylpropoxy)pentadeca-1,3,7-triene;2-methylprop-2-enal |
| SMILES | C=C(/C=C\C(=C)C(=C)/C(=C\C(=C)C(C)CCC(C)C(C)OCC(C)C)CCOC)OC.C=C(C)C=O |
| InChI | InChI=1S/C28H46O3.C4H6O/c1-20(2)19-31-27(9)23(5)13-12-21(3)24(6)18-28(16-17-29-10)26(8)22(4)14-15-25(7)30-11;1-4(2)3-5/h14-15,18,20-21,23,27H,4,6-8,12-13,16-17,19H2,1-3,5,9-11H3;3H,1H2,2H3/b15-14-,28-18-; |
| InChIKey | QWGYSNALTRDYKN-QPLYEXJDSA-N |
| XLogP | 8.21 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.76 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|