C31H50O3 — CID 145122489
ethane;[(3Z,7Z,11Z)-11-ethyl-3-(1-methoxyethenyl)-10,13-dimethyl-5,6,9-trimethylidenepentadeca-3,7,11-trienyl] formate;prop-1-ene (PubChem CID 145122489) has the molecular formula C31H50O3 and a molecular weight of 470.74 g/mol. Its IUPAC name is ethane;[(3Z,7Z,11Z)-11-ethyl-3-(1-methoxyethenyl)-10,13-dimethyl-5,6,9-trimethylidenepentadeca-3,7,11-trienyl] formate;prop-1-ene.
| Compound Name | ethane;[(3Z,7Z,11Z)-11-ethyl-3-(1-methoxyethenyl)-10,13-dimethyl-5,6,9-trimethylidenepentadeca-3,7,11-trienyl] formate;prop-1-ene |
|---|---|
| PubChem CID | 145122489 |
| Molecular Formula | C31H50O3 |
| Molecular Weight | 470.74 g/mol |
| Exact Mass | 470.38 |
| IUPAC Name | ethane;[(3Z,7Z,11Z)-11-ethyl-3-(1-methoxyethenyl)-10,13-dimethyl-5,6,9-trimethylidenepentadeca-3,7,11-trienyl] formate;prop-1-ene |
| SMILES | C=C(/C=C\C(=C)C(C)/C(=C\C(C)CC)CC)C(=C)/C=C(/CCOC=O)C(=C)OC.C=CC.CC |
| InChI | InChI=1S/C26H38O3.C3H6.C2H6/c1-10-19(3)16-25(11-2)23(7)21(5)13-12-20(4)22(6)17-26(24(8)28-9)14-15-29-18-27;1-3-2;1-2/h12-13,16-19,23H,4-6,8,10-11,14-15H2,1-3,7,9H3;3H,1H2,2H3;1-2H3/b13-12-,25-16-,26-17-;; |
| InChIKey | UPRPPWTWUUYRKH-XPTMWHENSA-N |
| XLogP | 9.10 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.74 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|