C26H46O2 — CID 145122491
(E)-4-(methoxymethyl)-7,10,11,14-tetramethyl-3,6-dimethylidenepentadec-4-ene;prop-2-enal (PubChem CID 145122491) has the molecular formula C26H46O2 and a molecular weight of 390.65 g/mol. Its IUPAC name is (E)-4-(methoxymethyl)-7,10,11,14-tetramethyl-3,6-dimethylidenepentadec-4-ene;prop-2-enal.
| Compound Name | (E)-4-(methoxymethyl)-7,10,11,14-tetramethyl-3,6-dimethylidenepentadec-4-ene;prop-2-enal |
|---|---|
| PubChem CID | 145122491 |
| Molecular Formula | C26H46O2 |
| Molecular Weight | 390.65 g/mol |
| Exact Mass | 390.35 |
| IUPAC Name | (E)-4-(methoxymethyl)-7,10,11,14-tetramethyl-3,6-dimethylidenepentadec-4-ene;prop-2-enal |
| SMILES | C=C(CC)/C(=C\C(=C)C(C)CCC(C)C(C)CCC(C)C)COC.C=CC=O |
| InChI | InChI=1S/C23H42O.C3H4O/c1-10-18(4)23(16-24-9)15-22(8)21(7)14-13-20(6)19(5)12-11-17(2)3;1-2-3-4/h15,17,19-21H,4,8,10-14,16H2,1-3,5-7,9H3;2-3H,1H2/b23-15-; |
| InChIKey | AQLUFGZIADQXAZ-HNALGXGESA-N |
| XLogP | 7.58 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.65 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|