C35H60O3 — CID 145122501
acetaldehyde;(3Z,7Z)-2-methoxy-3-(methoxymethyl)-7,10,13,14,17-pentamethyl-5,6,9-trimethylidenenonadeca-1,3,7-triene;prop-1-ene (PubChem CID 145122501) has the molecular formula C35H60O3 and a molecular weight of 528.86 g/mol. Its IUPAC name is acetaldehyde;(3Z,7Z)-2-methoxy-3-(methoxymethyl)-7,10,13,14,17-pentamethyl-5,6,9-trimethylidenenonadeca-1,3,7-triene;prop-1-ene.
| Compound Name | acetaldehyde;(3Z,7Z)-2-methoxy-3-(methoxymethyl)-7,10,13,14,17-pentamethyl-5,6,9-trimethylidenenonadeca-1,3,7-triene;prop-1-ene |
|---|---|
| PubChem CID | 145122501 |
| Molecular Formula | C35H60O3 |
| Molecular Weight | 528.86 g/mol |
| Exact Mass | 528.45 |
| IUPAC Name | acetaldehyde;(3Z,7Z)-2-methoxy-3-(methoxymethyl)-7,10,13,14,17-pentamethyl-5,6,9-trimethylidenenonadeca-1,3,7-triene;prop-1-ene |
| SMILES | C=C(/C=C(/COC)C(=C)OC)C(=C)/C(C)=C\C(=C)C(C)CCC(C)C(C)CCC(C)CC.C=CC.CC=O |
| InChI | InChI=1S/C30H50O2.C3H6.C2H4O/c1-13-21(2)14-15-22(3)23(4)16-17-24(5)25(6)18-26(7)28(9)27(8)19-30(20-31-11)29(10)32-12;1-3-2;1-2-3/h18-19,21-24H,6,8-10,13-17,20H2,1-5,7,11-12H3;3H,1H2,2H3;2H,1H3/b26-18-,30-19-;; |
| InChIKey | NOTNYTVXVOCQTB-AHYFHQLFSA-N |
| XLogP | 10.25 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.86 |
| LogP ≤ 5 | 10.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|