C20H25FO3 — CID 145122528
2-[(4E,8E)-8-fluoro-10-methyl-3,6,7-trimethylideneundeca-4,8,10-trien-4-yl]oxyethyl prop-2-enoate (PubChem CID 145122528) has the molecular formula C20H25FO3 and a molecular weight of 332.42 g/mol. Its IUPAC name is 2-[(4E,8E)-8-fluoro-10-methyl-3,6,7-trimethylideneundeca-4,8,10-trien-4-yl]oxyethyl prop-2-enoate.
| Compound Name | 2-[(4E,8E)-8-fluoro-10-methyl-3,6,7-trimethylideneundeca-4,8,10-trien-4-yl]oxyethyl prop-2-enoate |
|---|---|
| PubChem CID | 145122528 |
| Molecular Formula | C20H25FO3 |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | 2-[(4E,8E)-8-fluoro-10-methyl-3,6,7-trimethylideneundeca-4,8,10-trien-4-yl]oxyethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCO/C(=C\C(=C)C(=C)/C(F)=C\C(=C)C)C(=C)CC |
| InChI | InChI=1S/C20H25FO3/c1-8-15(5)19(23-10-11-24-20(22)9-2)13-16(6)17(7)18(21)12-14(3)4/h9,12-13H,2-3,5-8,10-11H2,1,4H3/b18-12+,19-13+ |
| InChIKey | YWNFYVNSYDYADY-KLCVKJMQSA-N |
| XLogP | 5.12 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|