C20H34O2 — CID 145122550
[(E)-7,10-dimethyl-3,6-dimethylideneundec-4-en-5-yl] prop-2-enoate;ethane (PubChem CID 145122550) has the molecular formula C20H34O2 and a molecular weight of 306.49 g/mol. Its IUPAC name is [(E)-7,10-dimethyl-3,6-dimethylideneundec-4-en-5-yl] prop-2-enoate;ethane.
| Compound Name | [(E)-7,10-dimethyl-3,6-dimethylideneundec-4-en-5-yl] prop-2-enoate;ethane |
|---|---|
| PubChem CID | 145122550 |
| Molecular Formula | C20H34O2 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.26 |
| IUPAC Name | [(E)-7,10-dimethyl-3,6-dimethylideneundec-4-en-5-yl] prop-2-enoate;ethane |
| SMILES | C=CC(=O)O/C(=C/C(=C)CC)C(=C)C(C)CCC(C)C.CC |
| InChI | InChI=1S/C18H28O2.C2H6/c1-8-14(5)12-17(20-18(19)9-2)16(7)15(6)11-10-13(3)4;1-2/h9,12-13,15H,2,5,7-8,10-11H2,1,3-4,6H3;1-2H3/b17-12+; |
| InChIKey | GRFWOTGKOFRYPQ-KCUXUEJTSA-N |
| XLogP | 6.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|