C28H40O2 — CID 145122584
(3R)-3-[(3E,7Z)-4-(methoxymethyl)-5,6,9-trimethylideneundeca-1,3,7-trien-2-yl]-3,5-dimethylcyclopentene;(E)-2-methylbut-2-enal (PubChem CID 145122584) has the molecular formula C28H40O2 and a molecular weight of 408.63 g/mol. Its IUPAC name is (3R)-3-[(3E,7Z)-4-(methoxymethyl)-5,6,9-trimethylideneundeca-1,3,7-trien-2-yl]-3,5-dimethylcyclopentene;(E)-2-methylbut-2-enal.
| Compound Name | (3R)-3-[(3E,7Z)-4-(methoxymethyl)-5,6,9-trimethylideneundeca-1,3,7-trien-2-yl]-3,5-dimethylcyclopentene;(E)-2-methylbut-2-enal |
|---|---|
| PubChem CID | 145122584 |
| Molecular Formula | C28H40O2 |
| Molecular Weight | 408.63 g/mol |
| Exact Mass | 408.30 |
| IUPAC Name | (3R)-3-[(3E,7Z)-4-(methoxymethyl)-5,6,9-trimethylideneundeca-1,3,7-trien-2-yl]-3,5-dimethylcyclopentene;(E)-2-methylbut-2-enal |
| SMILES | C/C=C(\C)C=O.C=C(/C=C\C(=C)C(=C)/C(=C\C(=C)[C@@]1(C)C=CC(C)C1)COC)CC |
| InChI | InChI=1S/C23H32O.C5H8O/c1-9-17(2)10-11-19(4)21(6)22(16-24-8)14-20(5)23(7)13-12-18(3)15-23;1-3-5(2)4-6/h10-14,18H,2,4-6,9,15-16H2,1,3,7-8H3;3-4H,1-2H3/b11-10-,22-14-;5-3+/t18?,23-;/m0./s1 |
| InChIKey | CYQZUZTXHDXQCB-WTTKKGEHSA-N |
| XLogP | 7.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.63 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|