C16H20O3 — CID 145122593
[(2E,5Z)-2-(2-methoxyprop-2-enylidene)-7-methyl-3,4-dimethylideneocta-5,7-dienyl] formate (PubChem CID 145122593) has the molecular formula C16H20O3 and a molecular weight of 260.33 g/mol. Its IUPAC name is [(2E,5Z)-2-(2-methoxyprop-2-enylidene)-7-methyl-3,4-dimethylideneocta-5,7-dienyl] formate.
| Compound Name | [(2E,5Z)-2-(2-methoxyprop-2-enylidene)-7-methyl-3,4-dimethylideneocta-5,7-dienyl] formate |
|---|---|
| PubChem CID | 145122593 |
| Molecular Formula | C16H20O3 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | [(2E,5Z)-2-(2-methoxyprop-2-enylidene)-7-methyl-3,4-dimethylideneocta-5,7-dienyl] formate |
| SMILES | C=C(C)/C=C\C(=C)C(=C)/C(=C\C(=C)OC)COC=O |
| InChI | InChI=1S/C16H20O3/c1-12(2)7-8-13(3)15(5)16(10-19-11-17)9-14(4)18-6/h7-9,11H,1,3-5,10H2,2,6H3/b8-7-,16-9- |
| InChIKey | IEFAXKOYQKWJCI-JGXBLWBFSA-N |
| XLogP | 3.49 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|