C27H44O2 — CID 145122595
ethane;(4E,8Z)-4-methoxy-11,14-dimethyl-3,6,7,10-tetramethylidenepentadeca-4,8-diene;prop-2-enal (PubChem CID 145122595) has the molecular formula C27H44O2 and a molecular weight of 400.65 g/mol. Its IUPAC name is ethane;(4E,8Z)-4-methoxy-11,14-dimethyl-3,6,7,10-tetramethylidenepentadeca-4,8-diene;prop-2-enal.
| Compound Name | ethane;(4E,8Z)-4-methoxy-11,14-dimethyl-3,6,7,10-tetramethylidenepentadeca-4,8-diene;prop-2-enal |
|---|---|
| PubChem CID | 145122595 |
| Molecular Formula | C27H44O2 |
| Molecular Weight | 400.65 g/mol |
| Exact Mass | 400.33 |
| IUPAC Name | ethane;(4E,8Z)-4-methoxy-11,14-dimethyl-3,6,7,10-tetramethylidenepentadeca-4,8-diene;prop-2-enal |
| SMILES | C=C(/C=C\C(=C)C(C)CCC(C)C)C(=C)/C=C(/OC)C(=C)CC.C=CC=O.CC |
| InChI | InChI=1S/C22H34O.C3H4O.C2H6/c1-10-17(4)22(23-9)15-21(8)20(7)14-13-19(6)18(5)12-11-16(2)3;1-2-3-4;1-2/h13-16,18H,4,6-8,10-12H2,1-3,5,9H3;2-3H,1H2;1-2H3/b14-13-,22-15+;; |
| InChIKey | UAHBHLMMFINUCO-ZBDOYCFKSA-N |
| XLogP | 8.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.65 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|