C29H41FO — CID 145122644
(4E,8E,12Z)-8-fluoro-4-(methoxymethyl)-15,18-dimethyl-3,6,7,10,11,14-hexamethylidenenonadeca-4,8,12-triene (PubChem CID 145122644) has the molecular formula C29H41FO and a molecular weight of 424.64 g/mol. Its IUPAC name is (4E,8E,12Z)-8-fluoro-4-(methoxymethyl)-15,18-dimethyl-3,6,7,10,11,14-hexamethylidenenonadeca-4,8,12-triene.
| Compound Name | (4E,8E,12Z)-8-fluoro-4-(methoxymethyl)-15,18-dimethyl-3,6,7,10,11,14-hexamethylidenenonadeca-4,8,12-triene |
|---|---|
| PubChem CID | 145122644 |
| Molecular Formula | C29H41FO |
| Molecular Weight | 424.64 g/mol |
| Exact Mass | 424.31 |
| IUPAC Name | (4E,8E,12Z)-8-fluoro-4-(methoxymethyl)-15,18-dimethyl-3,6,7,10,11,14-hexamethylidenenonadeca-4,8,12-triene |
| SMILES | C=C(/C=C\C(=C)C(C)CCC(C)C)C(=C)/C=C(/F)C(=C)C(=C)/C=C(\COC)C(=C)CC |
| InChI | InChI=1S/C29H41FO/c1-12-21(4)28(19-31-11)17-26(9)27(10)29(30)18-25(8)24(7)16-15-23(6)22(5)14-13-20(2)3/h15-18,20,22H,4,6-10,12-14,19H2,1-3,5,11H3/b16-15-,28-17-,29-18+ |
| InChIKey | KAOVODGHPPPRII-CNSLVAMKSA-N |
| XLogP | 8.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.64 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|