C30H46O3 — CID 145122680
(4E,8Z,12Z)-8-ethyl-4-(2-methoxyethoxy)-11,14-dimethyl-3,6,7,10-tetramethylidenehexadeca-4,8,12-triene;prop-2-enal (PubChem CID 145122680) has the molecular formula C30H46O3 and a molecular weight of 454.70 g/mol. Its IUPAC name is (4E,8Z,12Z)-8-ethyl-4-(2-methoxyethoxy)-11,14-dimethyl-3,6,7,10-tetramethylidenehexadeca-4,8,12-triene;prop-2-enal.
| Compound Name | (4E,8Z,12Z)-8-ethyl-4-(2-methoxyethoxy)-11,14-dimethyl-3,6,7,10-tetramethylidenehexadeca-4,8,12-triene;prop-2-enal |
|---|---|
| PubChem CID | 145122680 |
| Molecular Formula | C30H46O3 |
| Molecular Weight | 454.70 g/mol |
| Exact Mass | 454.34 |
| IUPAC Name | (4E,8Z,12Z)-8-ethyl-4-(2-methoxyethoxy)-11,14-dimethyl-3,6,7,10-tetramethylidenehexadeca-4,8,12-triene;prop-2-enal |
| SMILES | C=C(/C=C(/OCCOC)C(=C)CC)C(=C)/C(=C\C(=C)C(C)/C=C\C(C)CC)CC.C=CC=O |
| InChI | InChI=1S/C27H42O2.C3H4O/c1-11-20(4)14-15-22(6)23(7)18-26(13-3)25(9)24(8)19-27(21(5)12-2)29-17-16-28-10;1-2-3-4/h14-15,18-20,22H,5,7-9,11-13,16-17H2,1-4,6,10H3;2-3H,1H2/b15-14-,26-18-,27-19+; |
| InChIKey | BJJFBTDTKHYWGU-DMVNWGEESA-N |
| XLogP | 8.11 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.70 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|