C22H33FO3 — CID 145122729
fluoromethane;(3Z,7Z)-2-methoxy-3-(2-methoxyethyl)-5,6,9-trimethylideneundeca-1,3,7-triene;prop-2-enal (PubChem CID 145122729) has the molecular formula C22H33FO3 and a molecular weight of 364.50 g/mol. Its IUPAC name is fluoromethane;(3Z,7Z)-2-methoxy-3-(2-methoxyethyl)-5,6,9-trimethylideneundeca-1,3,7-triene;prop-2-enal.
| Compound Name | fluoromethane;(3Z,7Z)-2-methoxy-3-(2-methoxyethyl)-5,6,9-trimethylideneundeca-1,3,7-triene;prop-2-enal |
|---|---|
| PubChem CID | 145122729 |
| Molecular Formula | C22H33FO3 |
| Molecular Weight | 364.50 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | fluoromethane;(3Z,7Z)-2-methoxy-3-(2-methoxyethyl)-5,6,9-trimethylideneundeca-1,3,7-triene;prop-2-enal |
| SMILES | C=C(/C=C\C(=C)C(=C)/C=C(\CCOC)C(=C)OC)CC.C=CC=O.CF |
| InChI | InChI=1S/C18H26O2.C3H4O.CH3F/c1-8-14(2)9-10-15(3)16(4)13-18(11-12-19-6)17(5)20-7;1-2-3-4;1-2/h9-10,13H,2-5,8,11-12H2,1,6-7H3;2-3H,1H2;1H3/b10-9-,18-13-;; |
| InChIKey | IIFFDDRCFGVEHD-SEVBBOPJSA-N |
| XLogP | 5.70 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.50 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|