C27H38O4 — CID 145122741
2-[(3E,7Z,11Z)-2-methoxy-10,13-dimethyl-5,6,9-trimethylidenepentadeca-1,3,7,11-tetraen-3-yl]oxyethyl 2-methylprop-2-enoate (PubChem CID 145122741) has the molecular formula C27H38O4 and a molecular weight of 426.60 g/mol. Its IUPAC name is 2-[(3E,7Z,11Z)-2-methoxy-10,13-dimethyl-5,6,9-trimethylidenepentadeca-1,3,7,11-tetraen-3-yl]oxyethyl 2-methylprop-2-enoate.
| Compound Name | 2-[(3E,7Z,11Z)-2-methoxy-10,13-dimethyl-5,6,9-trimethylidenepentadeca-1,3,7,11-tetraen-3-yl]oxyethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 145122741 |
| Molecular Formula | C27H38O4 |
| Molecular Weight | 426.60 g/mol |
| Exact Mass | 426.28 |
| IUPAC Name | 2-[(3E,7Z,11Z)-2-methoxy-10,13-dimethyl-5,6,9-trimethylidenepentadeca-1,3,7,11-tetraen-3-yl]oxyethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCO/C(=C\C(=C)C(=C)/C=C\C(=C)C(C)/C=C\C(C)CC)C(=C)OC |
| InChI | InChI=1S/C27H38O4/c1-11-20(4)12-13-21(5)22(6)14-15-23(7)24(8)18-26(25(9)29-10)30-16-17-31-27(28)19(2)3/h12-15,18,20-21H,2,6-9,11,16-17H2,1,3-5,10H3/b13-12-,15-14-,26-18+ |
| InChIKey | QJAROZWYPJIRDP-UKHFAYIISA-N |
| XLogP | 6.63 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.60 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|