C35H56O3 — CID 145122815
(3Z,7Z,15Z)-2-methoxy-16-(2-methoxyethyl)-7,10,13,14,17-pentamethyl-5,6,9-trimethylidenenonadeca-1,3,7,15-tetraene;2-methylprop-2-enal (PubChem CID 145122815) has the molecular formula C35H56O3 and a molecular weight of 524.83 g/mol. Its IUPAC name is (3Z,7Z,15Z)-2-methoxy-16-(2-methoxyethyl)-7,10,13,14,17-pentamethyl-5,6,9-trimethylidenenonadeca-1,3,7,15-tetraene;2-methylprop-2-enal.
| Compound Name | (3Z,7Z,15Z)-2-methoxy-16-(2-methoxyethyl)-7,10,13,14,17-pentamethyl-5,6,9-trimethylidenenonadeca-1,3,7,15-tetraene;2-methylprop-2-enal |
|---|---|
| PubChem CID | 145122815 |
| Molecular Formula | C35H56O3 |
| Molecular Weight | 524.83 g/mol |
| Exact Mass | 524.42 |
| IUPAC Name | (3Z,7Z,15Z)-2-methoxy-16-(2-methoxyethyl)-7,10,13,14,17-pentamethyl-5,6,9-trimethylidenenonadeca-1,3,7,15-tetraene;2-methylprop-2-enal |
| SMILES | C=C(/C=C\C(=C)C(=C)/C(C)=C\C(=C)C(C)CCC(C)C(C)/C=C(/CCOC)C(C)CC)OC.C=C(C)C=O |
| InChI | InChI=1S/C31H50O2.C4H6O/c1-13-22(2)31(18-19-32-11)21-27(7)24(4)15-14-23(3)26(6)20-28(8)30(10)25(5)16-17-29(9)33-12;1-4(2)3-5/h16-17,20-24,27H,5-6,9-10,13-15,18-19H2,1-4,7-8,11-12H3;3H,1H2,2H3/b17-16-,28-20-,31-21-; |
| InChIKey | PQGIAFLQIJOXRR-PTHLORSXSA-N |
| XLogP | 9.78 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.83 |
| LogP ≤ 5 | 9.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|