C35H52O3 — CID 145122826
(4E,8Z,12Z)-9-ethyl-4-(2-methoxyethoxy)-15,18-dimethyl-3,6,7,10,11,14-hexamethylidenenonadeca-4,8,12-triene;prop-2-enal (PubChem CID 145122826) has the molecular formula C35H52O3 and a molecular weight of 520.80 g/mol. Its IUPAC name is (4E,8Z,12Z)-9-ethyl-4-(2-methoxyethoxy)-15,18-dimethyl-3,6,7,10,11,14-hexamethylidenenonadeca-4,8,12-triene;prop-2-enal.
| Compound Name | (4E,8Z,12Z)-9-ethyl-4-(2-methoxyethoxy)-15,18-dimethyl-3,6,7,10,11,14-hexamethylidenenonadeca-4,8,12-triene;prop-2-enal |
|---|---|
| PubChem CID | 145122826 |
| Molecular Formula | C35H52O3 |
| Molecular Weight | 520.80 g/mol |
| Exact Mass | 520.39 |
| IUPAC Name | (4E,8Z,12Z)-9-ethyl-4-(2-methoxyethoxy)-15,18-dimethyl-3,6,7,10,11,14-hexamethylidenenonadeca-4,8,12-triene;prop-2-enal |
| SMILES | C=C(/C=C(/CC)C(=C)C(=C)/C=C\C(=C)C(C)CCC(C)C)C(=C)/C=C(/OCCOC)C(=C)CC.C=CC=O |
| InChI | InChI=1S/C32H48O2.C3H4O/c1-13-24(5)32(34-20-19-33-12)22-29(10)28(9)21-31(14-2)30(11)27(8)18-17-26(7)25(6)16-15-23(3)4;1-2-3-4/h17-18,21-23,25H,5,7-11,13-16,19-20H2,1-4,6,12H3;2-3H,1H2/b18-17-,31-21-,32-22+; |
| InChIKey | OICAKJRWEQGLAW-FBTXKSRESA-N |
| XLogP | 9.62 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.80 |
| LogP ≤ 5 | 9.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|