C29H44F2O2 — CID 145122840
(4E,8Z,12Z)-8,9-difluoro-4-(methoxymethyl)-11,14-dimethyl-3,6,7,10-tetramethylidenehexadeca-4,8,12-triene;formaldehyde;2-methylprop-1-ene (PubChem CID 145122840) has the molecular formula C29H44F2O2 and a molecular weight of 462.67 g/mol. Its IUPAC name is (4E,8Z,12Z)-8,9-difluoro-4-(methoxymethyl)-11,14-dimethyl-3,6,7,10-tetramethylidenehexadeca-4,8,12-triene;formaldehyde;2-methylprop-1-ene.
| Compound Name | (4E,8Z,12Z)-8,9-difluoro-4-(methoxymethyl)-11,14-dimethyl-3,6,7,10-tetramethylidenehexadeca-4,8,12-triene;formaldehyde;2-methylprop-1-ene |
|---|---|
| PubChem CID | 145122840 |
| Molecular Formula | C29H44F2O2 |
| Molecular Weight | 462.67 g/mol |
| Exact Mass | 462.33 |
| IUPAC Name | (4E,8Z,12Z)-8,9-difluoro-4-(methoxymethyl)-11,14-dimethyl-3,6,7,10-tetramethylidenehexadeca-4,8,12-triene;formaldehyde;2-methylprop-1-ene |
| SMILES | C=C(/C=C(/COC)C(=C)CC)C(=C)/C(F)=C(\F)C(=C)C(C)/C=C\C(C)CC.C=C(C)C.C=O |
| InChI | InChI=1S/C24H34F2O.C4H8.CH2O/c1-10-16(3)12-13-18(5)20(7)23(25)24(26)21(8)19(6)14-22(15-27-9)17(4)11-2;1-4(2)3;1-2/h12-14,16,18H,4,6-8,10-11,15H2,1-3,5,9H3;1H2,2-3H3;1H2/b13-12-,22-14-,24-23-;; |
| InChIKey | ZDKCFVMVSRDNGZ-XDGQOWQOSA-N |
| XLogP | 8.98 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.67 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|