C31H43FO3 — CID 145122851
2-[(7E,11E,15Z)-12-fluoro-2,5-dimethyl-6,9,10,13,14,17-hexamethylidenenonadeca-7,11,15-trien-8-yl]oxyethyl acetate (PubChem CID 145122851) has the molecular formula C31H43FO3 and a molecular weight of 482.68 g/mol. Its IUPAC name is 2-[(7E,11E,15Z)-12-fluoro-2,5-dimethyl-6,9,10,13,14,17-hexamethylidenenonadeca-7,11,15-trien-8-yl]oxyethyl acetate.
| Compound Name | 2-[(7E,11E,15Z)-12-fluoro-2,5-dimethyl-6,9,10,13,14,17-hexamethylidenenonadeca-7,11,15-trien-8-yl]oxyethyl acetate |
|---|---|
| PubChem CID | 145122851 |
| Molecular Formula | C31H43FO3 |
| Molecular Weight | 482.68 g/mol |
| Exact Mass | 482.32 |
| IUPAC Name | 2-[(7E,11E,15Z)-12-fluoro-2,5-dimethyl-6,9,10,13,14,17-hexamethylidenenonadeca-7,11,15-trien-8-yl]oxyethyl acetate |
| SMILES | C=C(/C=C\C(=C)C(=C)/C(F)=C\C(=C)C(=C)/C(=C\C(=C)C(C)CCC(C)C)OCCOC(C)=O)CC |
| InChI | InChI=1S/C31H43FO3/c1-12-22(4)14-16-24(6)27(9)30(32)19-26(8)28(10)31(35-18-17-34-29(11)33)20-25(7)23(5)15-13-21(2)3/h14,16,19-21,23H,4,6-10,12-13,15,17-18H2,1-3,5,11H3/b16-14-,30-19+,31-20+ |
| InChIKey | SZVPWPUSVFVGMN-MMJQBCLVSA-N |
| XLogP | 8.68 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.68 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|