C34H55FO — CID 145122870
(4Z,8E)-4-but-1-en-2-yl-8-fluoro-11,14,15,18-tetramethyl-6,7,10-trimethylidene-1-(2-methylprop-2-enoxy)nonadeca-4,8-diene (PubChem CID 145122870) has the molecular formula C34H55FO and a molecular weight of 498.81 g/mol. Its IUPAC name is (4Z,8E)-4-but-1-en-2-yl-8-fluoro-11,14,15,18-tetramethyl-6,7,10-trimethylidene-1-(2-methylprop-2-enoxy)nonadeca-4,8-diene.
| Compound Name | (4Z,8E)-4-but-1-en-2-yl-8-fluoro-11,14,15,18-tetramethyl-6,7,10-trimethylidene-1-(2-methylprop-2-enoxy)nonadeca-4,8-diene |
|---|---|
| PubChem CID | 145122870 |
| Molecular Formula | C34H55FO |
| Molecular Weight | 498.81 g/mol |
| Exact Mass | 498.42 |
| IUPAC Name | (4Z,8E)-4-but-1-en-2-yl-8-fluoro-11,14,15,18-tetramethyl-6,7,10-trimethylidene-1-(2-methylprop-2-enoxy)nonadeca-4,8-diene |
| SMILES | C=C(C)COCCC/C(=C/C(=C)C(=C)/C(F)=C/C(=C)C(C)CCC(C)C(C)CCC(C)C)C(=C)CC |
| InChI | InChI=1S/C34H55FO/c1-13-26(6)33(15-14-20-36-23-25(4)5)21-31(11)32(12)34(35)22-30(10)29(9)19-18-28(8)27(7)17-16-24(2)3/h21-22,24,27-29H,4,6,10-20,23H2,1-3,5,7-9H3/b33-21-,34-22+ |
| InChIKey | QDKFUCHHICCBIV-NRYMNODQSA-N |
| XLogP | 10.90 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.81 |
| LogP ≤ 5 | 10.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|