C22H40O2 — CID 145122900
ethane;(E)-4-methoxy-7,10-dimethyl-3,6-dimethylidenedodec-4-ene;prop-2-enal (PubChem CID 145122900) has the molecular formula C22H40O2 and a molecular weight of 336.56 g/mol. Its IUPAC name is ethane;(E)-4-methoxy-7,10-dimethyl-3,6-dimethylidenedodec-4-ene;prop-2-enal.
| Compound Name | ethane;(E)-4-methoxy-7,10-dimethyl-3,6-dimethylidenedodec-4-ene;prop-2-enal |
|---|---|
| PubChem CID | 145122900 |
| Molecular Formula | C22H40O2 |
| Molecular Weight | 336.56 g/mol |
| Exact Mass | 336.30 |
| IUPAC Name | ethane;(E)-4-methoxy-7,10-dimethyl-3,6-dimethylidenedodec-4-ene;prop-2-enal |
| SMILES | C=C(CC)/C(=C\C(=C)C(C)CCC(C)CC)OC.C=CC=O.CC |
| InChI | InChI=1S/C17H30O.C3H4O.C2H6/c1-8-13(3)10-11-15(5)16(6)12-17(18-7)14(4)9-2;1-2-3-4;1-2/h12-13,15H,4,6,8-11H2,1-3,5,7H3;2-3H,1H2;1-2H3/b17-12+;; |
| InChIKey | HDFNBWUMYGLDRT-CWQUOYFRSA-N |
| XLogP | 6.90 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.56 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|