C29H46O2 — CID 145122911
ethene;(4Z,8E)-8-(methoxymethyl)-11,14-dimethyl-3,6,7,10-tetramethylidenehexadeca-4,8-diene;prop-2-enal (PubChem CID 145122911) has the molecular formula C29H46O2 and a molecular weight of 426.69 g/mol. Its IUPAC name is ethene;(4Z,8E)-8-(methoxymethyl)-11,14-dimethyl-3,6,7,10-tetramethylidenehexadeca-4,8-diene;prop-2-enal.
| Compound Name | ethene;(4Z,8E)-8-(methoxymethyl)-11,14-dimethyl-3,6,7,10-tetramethylidenehexadeca-4,8-diene;prop-2-enal |
|---|---|
| PubChem CID | 145122911 |
| Molecular Formula | C29H46O2 |
| Molecular Weight | 426.69 g/mol |
| Exact Mass | 426.35 |
| IUPAC Name | ethene;(4Z,8E)-8-(methoxymethyl)-11,14-dimethyl-3,6,7,10-tetramethylidenehexadeca-4,8-diene;prop-2-enal |
| SMILES | C=C.C=C(/C=C\C(=C)C(=C)/C(=C\C(=C)C(C)CCC(C)CC)COC)CC.C=CC=O |
| InChI | InChI=1S/C24H38O.C3H4O.C2H4/c1-10-18(3)12-14-20(5)22(7)16-24(17-25-9)23(8)21(6)15-13-19(4)11-2;1-2-3-4;1-2/h13,15-16,18,20H,4,6-8,10-12,14,17H2,1-3,5,9H3;2-3H,1H2;1-2H2/b15-13-,24-16-;; |
| InChIKey | OLICAZGPIMNAFO-AVJSPZMHSA-N |
| XLogP | 8.39 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.69 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|