C24H33FO2 — CID 145122951
(5S)-1-fluoro-5-[(3Z,7Z)-11-methoxy-8-(1-methoxyethenyl)-5,6-dimethylideneundeca-1,3,7-trien-2-yl]-3,5-dimethylcyclopentene (PubChem CID 145122951) has the molecular formula C24H33FO2 and a molecular weight of 372.52 g/mol. Its IUPAC name is (5S)-1-fluoro-5-[(3Z,7Z)-11-methoxy-8-(1-methoxyethenyl)-5,6-dimethylideneundeca-1,3,7-trien-2-yl]-3,5-dimethylcyclopentene.
| Compound Name | (5S)-1-fluoro-5-[(3Z,7Z)-11-methoxy-8-(1-methoxyethenyl)-5,6-dimethylideneundeca-1,3,7-trien-2-yl]-3,5-dimethylcyclopentene |
|---|---|
| PubChem CID | 145122951 |
| Molecular Formula | C24H33FO2 |
| Molecular Weight | 372.52 g/mol |
| Exact Mass | 372.25 |
| IUPAC Name | (5S)-1-fluoro-5-[(3Z,7Z)-11-methoxy-8-(1-methoxyethenyl)-5,6-dimethylideneundeca-1,3,7-trien-2-yl]-3,5-dimethylcyclopentene |
| SMILES | C=C(/C=C\C(=C)[C@]1(C)CC(C)C=C1F)C(=C)/C=C(/CCCOC)C(=C)OC |
| InChI | InChI=1S/C24H33FO2/c1-17-14-23(25)24(6,16-17)20(4)12-11-18(2)19(3)15-22(21(5)27-8)10-9-13-26-7/h11-12,14-15,17H,2-5,9-10,13,16H2,1,6-8H3/b12-11-,22-15-/t17?,24-/m0/s1 |
| InChIKey | FOPIVKRYCSOWMM-PBJBBCADSA-N |
| XLogP | 6.62 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.52 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|