C10H11IN2 — CID 145123011
1-iodo-3,5,6,7-tetrahydro-2H-pyrrolo[2,3-f]indole (PubChem CID 145123011) has the molecular formula C10H11IN2 and a molecular weight of 286.12 g/mol. Its IUPAC name is 1-iodo-3,5,6,7-tetrahydro-2H-pyrrolo[2,3-f]indole.
| Compound Name | 1-iodo-3,5,6,7-tetrahydro-2H-pyrrolo[2,3-f]indole |
|---|---|
| PubChem CID | 145123011 |
| Molecular Formula | C10H11IN2 |
| Molecular Weight | 286.12 g/mol |
| Exact Mass | 286.00 |
| IUPAC Name | 1-iodo-3,5,6,7-tetrahydro-2H-pyrrolo[2,3-f]indole |
| SMILES | IN1CCc2cc3c(cc21)CCN3 |
| InChI | InChI=1S/C10H11IN2/c11-13-4-2-8-5-9-7(1-3-12-9)6-10(8)13/h5-6,12H,1-4H2 |
| InChIKey | ONLUUVYVJWVDLU-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.12 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|