C7H9NS — CID 145123026
(5E)-4-ethenyl-5-ethylidene-4H-1,3-thiazole (PubChem CID 145123026) has the molecular formula C7H9NS and a molecular weight of 139.22 g/mol. Its IUPAC name is (5E)-4-ethenyl-5-ethylidene-4H-1,3-thiazole.
| Compound Name | (5E)-4-ethenyl-5-ethylidene-4H-1,3-thiazole |
|---|---|
| PubChem CID | 145123026 |
| Molecular Formula | C7H9NS |
| Molecular Weight | 139.22 g/mol |
| Exact Mass | 139.05 |
| IUPAC Name | (5E)-4-ethenyl-5-ethylidene-4H-1,3-thiazole |
| SMILES | C=CC1N=CS/C1=C/C |
| InChI | InChI=1S/C7H9NS/c1-3-6-7(4-2)9-5-8-6/h3-6H,1H2,2H3/b7-4+ |
| InChIKey | HZXDPHFXMSFOSW-QPJJXVBHSA-N |
| XLogP | 2.22 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.22 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|