About 6,7-bis(ethenyl)-3H-indole
6,7-bis(ethenyl)-3H-indole (PubChem CID 145123038) has the molecular formula C12H11N
and a molecular weight of 169.23 g/mol. Its IUPAC name is 6,7-bis(ethenyl)-3H-indole.
Molecular Properties
| Compound Name | 6,7-bis(ethenyl)-3H-indole |
| PubChem CID | 145123038 |
| Molecular Formula | C12H11N |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | 6,7-bis(ethenyl)-3H-indole |
| SMILES | C=Cc1ccc2c(c1C=C)N=CC2 |
| InChI | InChI=1S/C12H11N/c1-3-9-5-6-10-7-8-13-12(10)11(9)4-2/h3-6,8H,1-2,7H2 |
| InChIKey | RNSDRFAFOQAXHG-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6,7-bis(ethenyl)-3H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-bis(ethenyl)-3H-indole?
The IUPAC name of 6,7-bis(ethenyl)-3H-indole (CID 145123038) is 6,7-bis(ethenyl)-3H-indole.
What is the SMILES notation for 6,7-bis(ethenyl)-3H-indole?
The canonical SMILES for 6,7-bis(ethenyl)-3H-indole is C=Cc1ccc2c(c1C=C)N=CC2.
What is the InChIKey of 6,7-bis(ethenyl)-3H-indole?
The InChIKey is RNSDRFAFOQAXHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N/c1-3-9-5-6-10-7-8-13-12(10)11(9)4-2/h3-6,8H,1-2,7H2.
What are the key properties of 6,7-bis(ethenyl)-3H-indole?
6,7-bis(ethenyl)-3H-indole has a molecular weight of 169.23 g/mol, XLogP of 3.23, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-bis(ethenyl)-3H-indole is sourced from PubChem (CID 145123038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).