C45H52N2O9 — CID 145123130
4-O-[2-[1-(4-cyanophenyl)ethylideneamino]-4-[2-(4-formylcyclohexanecarbonyl)oxyethyl]-3-methylphenyl] 1-O-[4-(3-methoxy-2-methylpropoxy)phenyl] cyclohexane-1,4-dicarboxylate (PubChem CID 145123130) has the molecular formula C45H52N2O9 and a molecular weight of 764.92 g/mol. Its IUPAC name is 4-O-[2-[1-(4-cyanophenyl)ethylideneamino]-4-[2-(4-formylcyclohexanecarbonyl)oxyethyl]-3-methylphenyl] 1-O-[4-(3-methoxy-2-methylpropoxy)phenyl] cyclohexane-1,4-dicarboxylate.
| Compound Name | 4-O-[2-[1-(4-cyanophenyl)ethylideneamino]-4-[2-(4-formylcyclohexanecarbonyl)oxyethyl]-3-methylphenyl] 1-O-[4-(3-methoxy-2-methylpropoxy)phenyl] cyclohexane-1,4-dicarboxylate |
|---|---|
| PubChem CID | 145123130 |
| Molecular Formula | C45H52N2O9 |
| Molecular Weight | 764.92 g/mol |
| Exact Mass | 764.37 |
| IUPAC Name | 4-O-[2-[1-(4-cyanophenyl)ethylideneamino]-4-[2-(4-formylcyclohexanecarbonyl)oxyethyl]-3-methylphenyl] 1-O-[4-(3-methoxy-2-methylpropoxy)phenyl] cyclohexane-1,4-dicarboxylate |
| SMILES | COCC(C)COc1ccc(OC(=O)C2CCC(C(=O)Oc3ccc(CCOC(=O)C4CCC(C=O)CC4)c(C)c3/N=C(\C)c3ccc(C#N)cc3)CC2)cc1 |
| InChI | InChI=1S/C45H52N2O9/c1-29(27-52-4)28-54-39-18-20-40(21-19-39)55-44(50)37-13-15-38(16-14-37)45(51)56-41-22-17-34(23-24-53-43(49)36-11-7-33(26-48)8-12-36)30(2)42(41)47-31(3)35-9-5-32(25-46)6-10-35/h5-6,9-10,17-22,26,29,33,36-38H,7-8,11-16,23-24,27-28H2,1-4H3/b47-31+ |
| InChIKey | TUTUMNPJHNYRPD-UJVUWTAUSA-N |
| XLogP | 8.08 |
| TPSA | 150.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.92 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|