C11H17NO — CID 145123185
(3Z)-4-(ethenoxymethyl)-N,N-dimethylhexa-1,3,5-trien-3-amine (PubChem CID 145123185) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is (3Z)-4-(ethenoxymethyl)-N,N-dimethylhexa-1,3,5-trien-3-amine.
| Compound Name | (3Z)-4-(ethenoxymethyl)-N,N-dimethylhexa-1,3,5-trien-3-amine |
|---|---|
| PubChem CID | 145123185 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | (3Z)-4-(ethenoxymethyl)-N,N-dimethylhexa-1,3,5-trien-3-amine |
| SMILES | C=COC/C(C=C)=C(/C=C)N(C)C |
| InChI | InChI=1S/C11H17NO/c1-6-10(9-13-8-3)11(7-2)12(4)5/h6-8H,1-3,9H2,4-5H3/b11-10- |
| InChIKey | WQNFHXNHQHAFJE-KHPPLWFESA-N |
| XLogP | 2.33 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|