C26H28N2O4 — CID 145125184
3-(2,4-dihydroxy-5-propan-2-ylphenyl)-4-(11-tricyclo[7.4.0.03,6]trideca-1(9),10,12-trienyl)-1,2-oxazole-5-carboxamide (PubChem CID 145125184) has the molecular formula C26H28N2O4 and a molecular weight of 432.52 g/mol. Its IUPAC name is 3-(2,4-dihydroxy-5-propan-2-ylphenyl)-4-(11-tricyclo[7.4.0.03,6]trideca-1(9),10,12-trienyl)-1,2-oxazole-5-carboxamide.
| Compound Name | 3-(2,4-dihydroxy-5-propan-2-ylphenyl)-4-(11-tricyclo[7.4.0.03,6]trideca-1(9),10,12-trienyl)-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 145125184 |
| Molecular Formula | C26H28N2O4 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | 3-(2,4-dihydroxy-5-propan-2-ylphenyl)-4-(11-tricyclo[7.4.0.03,6]trideca-1(9),10,12-trienyl)-1,2-oxazole-5-carboxamide |
| SMILES | CC(C)c1cc(-c2noc(C(N)=O)c2-c2ccc3c(c2)CCC2CCC2C3)c(O)cc1O |
| InChI | InChI=1S/C26H28N2O4/c1-13(2)19-11-20(22(30)12-21(19)29)24-23(25(26(27)31)32-28-24)18-8-7-16-9-15-5-3-14(15)4-6-17(16)10-18/h7-8,10-15,29-30H,3-6,9H2,1-2H3,(H2,27,31) |
| InChIKey | ODKUPDGOTNYNIP-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |